C27H27ClFN5O4 — CID 89496186
(E)-N-[4-(3-chloro-4-fluoroanilino)-3-cyano-7-(oxolan-3-yloxy)quinolin-6-yl]-4-[1-hydroxyethyl(methyl)amino]but-2-enamide (PubChem CID 89496186) has the molecular formula C27H27ClFN5O4 and a molecular weight of 540.00 g/mol. Its IUPAC name is (E)-N-[4-(3-chloro-4-fluoroanilino)-3-cyano-7-(oxolan-3-yloxy)quinolin-6-yl]-4-[1-hydroxyethyl(methyl)amino]but-2-enamide.
| Compound Name | (E)-N-[4-(3-chloro-4-fluoroanilino)-3-cyano-7-(oxolan-3-yloxy)quinolin-6-yl]-4-[1-hydroxyethyl(methyl)amino]but-2-enamide |
|---|---|
| PubChem CID | 89496186 |
| Molecular Formula | C27H27ClFN5O4 |
| Molecular Weight | 540.00 g/mol |
| Exact Mass | 539.17 |
| IUPAC Name | (E)-N-[4-(3-chloro-4-fluoroanilino)-3-cyano-7-(oxolan-3-yloxy)quinolin-6-yl]-4-[1-hydroxyethyl(methyl)amino]but-2-enamide |
| SMILES | CC(O)N(C)C/C=C/C(=O)Nc1cc2c(Nc3ccc(F)c(Cl)c3)c(C#N)cnc2cc1OC1CCOC1 |
| InChI | InChI=1S/C27H27ClFN5O4/c1-16(35)34(2)8-3-4-26(36)33-24-11-20-23(12-25(24)38-19-7-9-37-15-19)31-14-17(13-30)27(20)32-18-5-6-22(29)21(28)10-18/h3-6,10-12,14,16,19,35H,7-9,15H2,1-2H3,(H,31,32)(H,33,36)/b4-3+ |
| InChIKey | HQBBUDXFJHNHEO-ONEGZZNKSA-N |
| XLogP | 4.58 |
| TPSA | 119.74 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 540.00 |
| LogP ≤ 5 | 4.58 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|