C28H29ClFN5O4 — CID 89496391
(E)-N-[4-(3-chloro-4-fluoroanilino)-3-cyano-7-(oxolan-3-yloxy)quinolin-6-yl]-4-(2-ethoxyethylamino)but-2-enamide (PubChem CID 89496391) has the molecular formula C28H29ClFN5O4 and a molecular weight of 554.02 g/mol. Its IUPAC name is (E)-N-[4-(3-chloro-4-fluoroanilino)-3-cyano-7-(oxolan-3-yloxy)quinolin-6-yl]-4-(2-ethoxyethylamino)but-2-enamide.
| Compound Name | (E)-N-[4-(3-chloro-4-fluoroanilino)-3-cyano-7-(oxolan-3-yloxy)quinolin-6-yl]-4-(2-ethoxyethylamino)but-2-enamide |
|---|---|
| PubChem CID | 89496391 |
| Molecular Formula | C28H29ClFN5O4 |
| Molecular Weight | 554.02 g/mol |
| Exact Mass | 553.19 |
| IUPAC Name | (E)-N-[4-(3-chloro-4-fluoroanilino)-3-cyano-7-(oxolan-3-yloxy)quinolin-6-yl]-4-(2-ethoxyethylamino)but-2-enamide |
| SMILES | CCOCCNC/C=C/C(=O)Nc1cc2c(Nc3ccc(F)c(Cl)c3)c(C#N)cnc2cc1OC1CCOC1 |
| InChI | InChI=1S/C28H29ClFN5O4/c1-2-37-11-9-32-8-3-4-27(36)35-25-13-21-24(14-26(25)39-20-7-10-38-17-20)33-16-18(15-31)28(21)34-19-5-6-23(30)22(29)12-19/h3-6,12-14,16,20,32H,2,7-11,17H2,1H3,(H,33,34)(H,35,36)/b4-3+ |
| InChIKey | NGSAJYOXSZWGDM-ONEGZZNKSA-N |
| XLogP | 4.93 |
| TPSA | 117.53 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 554.02 |
| LogP ≤ 5 | 4.93 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|