C36H39ClN6O5 — CID 123439918
N-[4-[3-chloro-4-(pyridin-2-ylmethoxy)anilino]-3-cyano-7-(oxolan-3-yloxy)quinolin-6-yl]-4-(6-hydroxyhexylamino)but-2-enamide (PubChem CID 123439918) has the molecular formula C36H39ClN6O5 and a molecular weight of 671.20 g/mol. Its IUPAC name is N-[4-[3-chloro-4-(pyridin-2-ylmethoxy)anilino]-3-cyano-7-(oxolan-3-yloxy)quinolin-6-yl]-4-(6-hydroxyhexylamino)but-2-enamide.
| Compound Name | N-[4-[3-chloro-4-(pyridin-2-ylmethoxy)anilino]-3-cyano-7-(oxolan-3-yloxy)quinolin-6-yl]-4-(6-hydroxyhexylamino)but-2-enamide |
|---|---|
| PubChem CID | 123439918 |
| Molecular Formula | C36H39ClN6O5 |
| Molecular Weight | 671.20 g/mol |
| Exact Mass | 670.27 |
| IUPAC Name | N-[4-[3-chloro-4-(pyridin-2-ylmethoxy)anilino]-3-cyano-7-(oxolan-3-yloxy)quinolin-6-yl]-4-(6-hydroxyhexylamino)but-2-enamide |
| SMILES | N#Cc1cnc2cc(OC3CCOC3)c(NC(=O)C=CCNCCCCCCO)cc2c1Nc1ccc(OCc2ccccn2)c(Cl)c1 |
| InChI | InChI=1S/C36H39ClN6O5/c37-30-18-26(10-11-33(30)47-23-27-8-3-5-15-40-27)42-36-25(21-38)22-41-31-20-34(48-28-12-17-46-24-28)32(19-29(31)36)43-35(45)9-7-14-39-13-4-1-2-6-16-44/h3,5,7-11,15,18-20,22,28,39,44H,1-2,4,6,12-14,16-17,23-24H2,(H,41,42)(H,43,45) |
| InChIKey | GBEOFNBADUQDFR-UHFFFAOYSA-N |
| XLogP | 6.28 |
| TPSA | 150.65 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 48 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 671.20 |
| LogP ≤ 5 | 6.28 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|