C35H35ClFN5O6 — CID 146255783
(E)-4-[bis[(1S)-1-hydroxyethyl]amino]-N-[4-[3-chloro-4-[(3-fluorophenyl)methoxy]anilino]-3-cyano-7-[(3S)-oxolan-3-yl]oxyquinolin-6-yl]but-2-enamide (PubChem CID 146255783) has the molecular formula C35H35ClFN5O6 and a molecular weight of 676.15 g/mol. Its IUPAC name is (E)-4-[bis[(1S)-1-hydroxyethyl]amino]-N-[4-[3-chloro-4-[(3-fluorophenyl)methoxy]anilino]-3-cyano-7-[(3S)-oxolan-3-yl]oxyquinolin-6-yl]but-2-enamide.
| Compound Name | (E)-4-[bis[(1S)-1-hydroxyethyl]amino]-N-[4-[3-chloro-4-[(3-fluorophenyl)methoxy]anilino]-3-cyano-7-[(3S)-oxolan-3-yl]oxyquinolin-6-yl]but-2-enamide |
|---|---|
| PubChem CID | 146255783 |
| Molecular Formula | C35H35ClFN5O6 |
| Molecular Weight | 676.15 g/mol |
| Exact Mass | 675.23 |
| IUPAC Name | (E)-4-[bis[(1S)-1-hydroxyethyl]amino]-N-[4-[3-chloro-4-[(3-fluorophenyl)methoxy]anilino]-3-cyano-7-[(3S)-oxolan-3-yl]oxyquinolin-6-yl]but-2-enamide |
| SMILES | C[C@H](O)N(C/C=C/C(=O)Nc1cc2c(Nc3ccc(OCc4cccc(F)c4)c(Cl)c3)c(C#N)cnc2cc1O[C@H]1CCOC1)[C@H](C)O |
| InChI | InChI=1S/C35H35ClFN5O6/c1-21(43)42(22(2)44)11-4-7-34(45)41-31-15-28-30(16-33(31)48-27-10-12-46-20-27)39-18-24(17-38)35(28)40-26-8-9-32(29(36)14-26)47-19-23-5-3-6-25(37)13-23/h3-9,13-16,18,21-22,27,43-44H,10-12,19-20H2,1-2H3,(H,39,40)(H,41,45)/b7-4+/t21-,22-,27-/m0/s1 |
| InChIKey | QIRQUYGBIFNOPB-MNJZQGBMSA-N |
| XLogP | 5.86 |
| TPSA | 149.20 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 48 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 676.15 |
| LogP ≤ 5 | 5.86 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|