C31H32N6O2 — CID 56592389
N-[3-cyano-4-(3-ethynylanilino)-7-(1-methylpiperidin-4-yl)oxyquinolin-6-yl]-2-piperidin-4-ylideneacetamide (PubChem CID 56592389) has the molecular formula C31H32N6O2 and a molecular weight of 520.64 g/mol. Its IUPAC name is N-[3-cyano-4-(3-ethynylanilino)-7-(1-methylpiperidin-4-yl)oxyquinolin-6-yl]-2-piperidin-4-ylideneacetamide.
| Compound Name | N-[3-cyano-4-(3-ethynylanilino)-7-(1-methylpiperidin-4-yl)oxyquinolin-6-yl]-2-piperidin-4-ylideneacetamide |
|---|---|
| PubChem CID | 56592389 |
| Molecular Formula | C31H32N6O2 |
| Molecular Weight | 520.64 g/mol |
| Exact Mass | 520.26 |
| IUPAC Name | N-[3-cyano-4-(3-ethynylanilino)-7-(1-methylpiperidin-4-yl)oxyquinolin-6-yl]-2-piperidin-4-ylideneacetamide |
| SMILES | C#Cc1cccc(Nc2c(C#N)cnc3cc(OC4CCN(C)CC4)c(NC(=O)C=C4CCNCC4)cc23)c1 |
| InChI | InChI=1S/C31H32N6O2/c1-3-21-5-4-6-24(15-21)35-31-23(19-32)20-34-27-18-29(39-25-9-13-37(2)14-10-25)28(17-26(27)31)36-30(38)16-22-7-11-33-12-8-22/h1,4-6,15-18,20,25,33H,7-14H2,2H3,(H,34,35)(H,36,38) |
| InChIKey | IDMHFSBCGRFMMJ-UHFFFAOYSA-N |
| XLogP | 4.55 |
| TPSA | 102.31 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 520.64 |
| LogP ≤ 5 | 4.55 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|