C32H30FN5O3 — CID 67962595
N-[3-cyano-4-[4-[(3-fluorophenyl)methoxy]-3-methylanilino]-7-methoxyquinolin-6-yl]-2-piperidin-4-ylideneacetamide (PubChem CID 67962595) has the molecular formula C32H30FN5O3 and a molecular weight of 551.62 g/mol. Its IUPAC name is N-[3-cyano-4-[4-[(3-fluorophenyl)methoxy]-3-methylanilino]-7-methoxyquinolin-6-yl]-2-piperidin-4-ylideneacetamide.
| Compound Name | N-[3-cyano-4-[4-[(3-fluorophenyl)methoxy]-3-methylanilino]-7-methoxyquinolin-6-yl]-2-piperidin-4-ylideneacetamide |
|---|---|
| PubChem CID | 67962595 |
| Molecular Formula | C32H30FN5O3 |
| Molecular Weight | 551.62 g/mol |
| Exact Mass | 551.23 |
| IUPAC Name | N-[3-cyano-4-[4-[(3-fluorophenyl)methoxy]-3-methylanilino]-7-methoxyquinolin-6-yl]-2-piperidin-4-ylideneacetamide |
| SMILES | COc1cc2ncc(C#N)c(Nc3ccc(OCc4cccc(F)c4)c(C)c3)c2cc1NC(=O)C=C1CCNCC1 |
| InChI | InChI=1S/C32H30FN5O3/c1-20-12-25(6-7-29(20)41-19-22-4-3-5-24(33)13-22)37-32-23(17-34)18-36-27-16-30(40-2)28(15-26(27)32)38-31(39)14-21-8-10-35-11-9-21/h3-7,12-16,18,35H,8-11,19H2,1-2H3,(H,36,37)(H,38,39) |
| InChIKey | BOSLJSDNHRNFTG-UHFFFAOYSA-N |
| XLogP | 6.13 |
| TPSA | 108.30 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 551.62 |
| LogP ≤ 5 | 6.13 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|