C30H26ClFN4O4S2 — CID 135236876
N-[4-[3-chloro-4-[(3-fluorophenyl)methoxy]anilino]-3-cyano-7-ethoxyquinolin-6-yl]-2-(2-oxodithiolan-3-yl)acetamide (PubChem CID 135236876) has the molecular formula C30H26ClFN4O4S2 and a molecular weight of 625.15 g/mol. Its IUPAC name is N-[4-[3-chloro-4-[(3-fluorophenyl)methoxy]anilino]-3-cyano-7-ethoxyquinolin-6-yl]-2-(2-oxodithiolan-3-yl)acetamide.
| Compound Name | N-[4-[3-chloro-4-[(3-fluorophenyl)methoxy]anilino]-3-cyano-7-ethoxyquinolin-6-yl]-2-(2-oxodithiolan-3-yl)acetamide |
|---|---|
| PubChem CID | 135236876 |
| Molecular Formula | C30H26ClFN4O4S2 |
| Molecular Weight | 625.15 g/mol |
| Exact Mass | 624.11 |
| IUPAC Name | N-[4-[3-chloro-4-[(3-fluorophenyl)methoxy]anilino]-3-cyano-7-ethoxyquinolin-6-yl]-2-(2-oxodithiolan-3-yl)acetamide |
| SMILES | CCOc1cc2ncc(C#N)c(Nc3ccc(OCc4cccc(F)c4)c(Cl)c3)c2cc1NC(=O)CC1CCSS1=O |
| InChI | InChI=1S/C30H26ClFN4O4S2/c1-2-39-28-14-25-23(13-26(28)36-29(37)12-22-8-9-41-42(22)38)30(19(15-33)16-34-25)35-21-6-7-27(24(31)11-21)40-17-18-4-3-5-20(32)10-18/h3-7,10-11,13-14,16,22H,2,8-9,12,17H2,1H3,(H,34,35)(H,36,37) |
| InChIKey | PTRDXTKIYDZKLI-UHFFFAOYSA-N |
| XLogP | 7.12 |
| TPSA | 113.34 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 625.15 |
| LogP ≤ 5 | 7.12 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'disulphide', 'substructure': 'N/A'} |
|---|