C30H26ClFN4O5S2 — CID 135236895
N-[4-[3-chloro-4-[(3-fluorophenyl)methoxy]anilino]-3-cyano-7-(2,3-dihydroxypropoxy)quinolin-6-yl]dithiolane-3-carboxamide (PubChem CID 135236895) has the molecular formula C30H26ClFN4O5S2 and a molecular weight of 641.15 g/mol. Its IUPAC name is N-[4-[3-chloro-4-[(3-fluorophenyl)methoxy]anilino]-3-cyano-7-(2,3-dihydroxypropoxy)quinolin-6-yl]dithiolane-3-carboxamide.
| Compound Name | N-[4-[3-chloro-4-[(3-fluorophenyl)methoxy]anilino]-3-cyano-7-(2,3-dihydroxypropoxy)quinolin-6-yl]dithiolane-3-carboxamide |
|---|---|
| PubChem CID | 135236895 |
| Molecular Formula | C30H26ClFN4O5S2 |
| Molecular Weight | 641.15 g/mol |
| Exact Mass | 640.10 |
| IUPAC Name | N-[4-[3-chloro-4-[(3-fluorophenyl)methoxy]anilino]-3-cyano-7-(2,3-dihydroxypropoxy)quinolin-6-yl]dithiolane-3-carboxamide |
| SMILES | N#Cc1cnc2cc(OCC(O)CO)c(NC(=O)C3CCSS3)cc2c1Nc1ccc(OCc2cccc(F)c2)c(Cl)c1 |
| InChI | InChI=1S/C30H26ClFN4O5S2/c31-23-9-20(4-5-26(23)40-15-17-2-1-3-19(32)8-17)35-29-18(12-33)13-34-24-11-27(41-16-21(38)14-37)25(10-22(24)29)36-30(39)28-6-7-42-43-28/h1-5,8-11,13,21,28,37-38H,6-7,14-16H2,(H,34,35)(H,36,39) |
| InChIKey | NNZCIAFBGGSMID-UHFFFAOYSA-N |
| XLogP | 6.05 |
| TPSA | 136.73 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 641.15 |
| LogP ≤ 5 | 6.05 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'disulphide', 'substructure': 'N/A'} |
|---|