C31H28ClFN4O5S2 — CID 135236450
N-[4-[3-chloro-4-[(3-fluorophenyl)methoxy]anilino]-3-cyano-7-[(2R)-2,3-dihydroxypropoxy]quinolin-6-yl]-2-(dithiolan-3-yl)acetamide (PubChem CID 135236450) has the molecular formula C31H28ClFN4O5S2 and a molecular weight of 655.17 g/mol. Its IUPAC name is N-[4-[3-chloro-4-[(3-fluorophenyl)methoxy]anilino]-3-cyano-7-[(2R)-2,3-dihydroxypropoxy]quinolin-6-yl]-2-(dithiolan-3-yl)acetamide.
| Compound Name | N-[4-[3-chloro-4-[(3-fluorophenyl)methoxy]anilino]-3-cyano-7-[(2R)-2,3-dihydroxypropoxy]quinolin-6-yl]-2-(dithiolan-3-yl)acetamide |
|---|---|
| PubChem CID | 135236450 |
| Molecular Formula | C31H28ClFN4O5S2 |
| Molecular Weight | 655.17 g/mol |
| Exact Mass | 654.12 |
| IUPAC Name | N-[4-[3-chloro-4-[(3-fluorophenyl)methoxy]anilino]-3-cyano-7-[(2R)-2,3-dihydroxypropoxy]quinolin-6-yl]-2-(dithiolan-3-yl)acetamide |
| SMILES | N#Cc1cnc2cc(OC[C@H](O)CO)c(NC(=O)CC3CCSS3)cc2c1Nc1ccc(OCc2cccc(F)c2)c(Cl)c1 |
| InChI | InChI=1S/C31H28ClFN4O5S2/c32-25-9-21(4-5-28(25)41-16-18-2-1-3-20(33)8-18)36-31-19(13-34)14-35-26-12-29(42-17-22(39)15-38)27(11-24(26)31)37-30(40)10-23-6-7-43-44-23/h1-5,8-9,11-12,14,22-23,38-39H,6-7,10,15-17H2,(H,35,36)(H,37,40)/t22-,23?/m1/s1 |
| InChIKey | KVMBBUXCOHWOBJ-WTQRLHSKSA-N |
| XLogP | 6.44 |
| TPSA | 136.73 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 655.17 |
| LogP ≤ 5 | 6.44 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'disulphide', 'substructure': 'N/A'} |
|---|