C25H26ClFN4O6S2 — CID 135236920
N-[4-(3-chloro-4-fluoroanilino)-3-cyano-7-(2,3-dihydroxypropoxy)quinolin-6-yl]-3-(1,1-dihydroxydithiolan-3-yl)propanamide (PubChem CID 135236920) has the molecular formula C25H26ClFN4O6S2 and a molecular weight of 597.09 g/mol. Its IUPAC name is N-[4-(3-chloro-4-fluoroanilino)-3-cyano-7-(2,3-dihydroxypropoxy)quinolin-6-yl]-3-(1,1-dihydroxydithiolan-3-yl)propanamide.
| Compound Name | N-[4-(3-chloro-4-fluoroanilino)-3-cyano-7-(2,3-dihydroxypropoxy)quinolin-6-yl]-3-(1,1-dihydroxydithiolan-3-yl)propanamide |
|---|---|
| PubChem CID | 135236920 |
| Molecular Formula | C25H26ClFN4O6S2 |
| Molecular Weight | 597.09 g/mol |
| Exact Mass | 596.10 |
| IUPAC Name | N-[4-(3-chloro-4-fluoroanilino)-3-cyano-7-(2,3-dihydroxypropoxy)quinolin-6-yl]-3-(1,1-dihydroxydithiolan-3-yl)propanamide |
| SMILES | N#Cc1cnc2cc(OCC(O)CO)c(NC(=O)CCC3CCS(O)(O)S3)cc2c1Nc1ccc(F)c(Cl)c1 |
| InChI | InChI=1S/C25H26ClFN4O6S2/c26-19-7-15(1-3-20(19)27)30-25-14(10-28)11-29-21-9-23(37-13-16(33)12-32)22(8-18(21)25)31-24(34)4-2-17-5-6-39(35,36)38-17/h1,3,7-9,11,16-17,32-33,35-36H,2,4-6,12-13H2,(H,29,30)(H,31,34) |
| InChIKey | VXMZQRXLAGHECT-UHFFFAOYSA-N |
| XLogP | 5.26 |
| TPSA | 167.96 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 39 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 597.09 |
| LogP ≤ 5 | 5.26 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'disulphide', 'substructure': 'N/A'} |
|---|