C22H18ClFN4O3S2 — CID 135236491
N-[4-(3-chloro-4-fluoroanilino)-3-cyano-7-ethoxyquinolin-6-yl]-1-oxodithiolane-4-carboxamide (PubChem CID 135236491) has the molecular formula C22H18ClFN4O3S2 and a molecular weight of 505.00 g/mol. Its IUPAC name is N-[4-(3-chloro-4-fluoroanilino)-3-cyano-7-ethoxyquinolin-6-yl]-1-oxodithiolane-4-carboxamide.
| Compound Name | N-[4-(3-chloro-4-fluoroanilino)-3-cyano-7-ethoxyquinolin-6-yl]-1-oxodithiolane-4-carboxamide |
|---|---|
| PubChem CID | 135236491 |
| Molecular Formula | C22H18ClFN4O3S2 |
| Molecular Weight | 505.00 g/mol |
| Exact Mass | 504.05 |
| IUPAC Name | N-[4-(3-chloro-4-fluoroanilino)-3-cyano-7-ethoxyquinolin-6-yl]-1-oxodithiolane-4-carboxamide |
| SMILES | CCOc1cc2ncc(C#N)c(Nc3ccc(F)c(Cl)c3)c2cc1NC(=O)C1CSS(=O)C1 |
| InChI | InChI=1S/C22H18ClFN4O3S2/c1-2-31-20-7-18-15(6-19(20)28-22(29)13-10-32-33(30)11-13)21(12(8-25)9-26-18)27-14-3-4-17(24)16(23)5-14/h3-7,9,13H,2,10-11H2,1H3,(H,26,27)(H,28,29) |
| InChIKey | FWLXUMYBRNKBRE-UHFFFAOYSA-N |
| XLogP | 5.01 |
| TPSA | 104.11 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 505.00 |
| LogP ≤ 5 | 5.01 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'disulphide', 'substructure': 'N/A'} |
|---|