C21H18ClFN4O5S3 — CID 135236599
N-[4-(3-chloro-4-fluoroanilino)-3-cyano-7-ethoxyquinolin-6-yl]-1,1-dioxodithiolane-4-sulfonamide (PubChem CID 135236599) has the molecular formula C21H18ClFN4O5S3 and a molecular weight of 557.05 g/mol. Its IUPAC name is N-[4-(3-chloro-4-fluoroanilino)-3-cyano-7-ethoxyquinolin-6-yl]-1,1-dioxodithiolane-4-sulfonamide.
| Compound Name | N-[4-(3-chloro-4-fluoroanilino)-3-cyano-7-ethoxyquinolin-6-yl]-1,1-dioxodithiolane-4-sulfonamide |
|---|---|
| PubChem CID | 135236599 |
| Molecular Formula | C21H18ClFN4O5S3 |
| Molecular Weight | 557.05 g/mol |
| Exact Mass | 556.01 |
| IUPAC Name | N-[4-(3-chloro-4-fluoroanilino)-3-cyano-7-ethoxyquinolin-6-yl]-1,1-dioxodithiolane-4-sulfonamide |
| SMILES | CCOc1cc2ncc(C#N)c(Nc3ccc(F)c(Cl)c3)c2cc1NS(=O)(=O)C1CSS(=O)(=O)C1 |
| InChI | InChI=1S/C21H18ClFN4O5S3/c1-2-32-20-7-18-15(6-19(20)27-35(30,31)14-10-33-34(28,29)11-14)21(12(8-24)9-25-18)26-13-3-4-17(23)16(22)5-13/h3-7,9,14,27H,2,10-11H2,1H3,(H,25,26) |
| InChIKey | LVFPOAZCQIWJQK-UHFFFAOYSA-N |
| XLogP | 4.23 |
| TPSA | 138.25 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 557.05 |
| LogP ≤ 5 | 4.23 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'disulphide', 'substructure': 'N/A'} |
|---|