C29H18ClF4N5O2 — CID 141402058
N-[4-(3-chloro-4-fluoroanilino)-3-cyano-7-ethoxyquinolin-6-yl]-2-cyano-3-[4-(trifluoromethyl)phenyl]prop-2-enamide (PubChem CID 141402058) has the molecular formula C29H18ClF4N5O2 and a molecular weight of 579.94 g/mol. Its IUPAC name is N-[4-(3-chloro-4-fluoroanilino)-3-cyano-7-ethoxyquinolin-6-yl]-2-cyano-3-[4-(trifluoromethyl)phenyl]prop-2-enamide.
| Compound Name | N-[4-(3-chloro-4-fluoroanilino)-3-cyano-7-ethoxyquinolin-6-yl]-2-cyano-3-[4-(trifluoromethyl)phenyl]prop-2-enamide |
|---|---|
| PubChem CID | 141402058 |
| Molecular Formula | C29H18ClF4N5O2 |
| Molecular Weight | 579.94 g/mol |
| Exact Mass | 579.11 |
| IUPAC Name | N-[4-(3-chloro-4-fluoroanilino)-3-cyano-7-ethoxyquinolin-6-yl]-2-cyano-3-[4-(trifluoromethyl)phenyl]prop-2-enamide |
| SMILES | CCOc1cc2ncc(C#N)c(Nc3ccc(F)c(Cl)c3)c2cc1NC(=O)C(C#N)=Cc1ccc(C(F)(F)F)cc1 |
| InChI | InChI=1S/C29H18ClF4N5O2/c1-2-41-26-12-24-21(27(18(14-36)15-37-24)38-20-7-8-23(31)22(30)10-20)11-25(26)39-28(40)17(13-35)9-16-3-5-19(6-4-16)29(32,33)34/h3-12,15H,2H2,1H3,(H,37,38)(H,39,40) |
| InChIKey | OFIMXOYKVRYEKB-UHFFFAOYSA-N |
| XLogP | 7.61 |
| TPSA | 110.83 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 579.94 |
| LogP ≤ 5 | 7.61 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|