C27H26Cl2F2N8O2 — CID 46937463
(E)-N-[4-(3-chloro-4-fluoroanilino)-3-cyano-7-ethoxyquinolin-6-yl]-4-[[1-(2-fluoroethyl)triazol-4-yl]methylamino]but-2-enamide;hydrochloride (PubChem CID 46937463) has the molecular formula C27H26Cl2F2N8O2 and a molecular weight of 603.46 g/mol. Its IUPAC name is (E)-N-[4-(3-chloro-4-fluoroanilino)-3-cyano-7-ethoxyquinolin-6-yl]-4-[[1-(2-fluoroethyl)triazol-4-yl]methylamino]but-2-enamide;hydrochloride.
| Compound Name | (E)-N-[4-(3-chloro-4-fluoroanilino)-3-cyano-7-ethoxyquinolin-6-yl]-4-[[1-(2-fluoroethyl)triazol-4-yl]methylamino]but-2-enamide;hydrochloride |
|---|---|
| PubChem CID | 46937463 |
| Molecular Formula | C27H26Cl2F2N8O2 |
| Molecular Weight | 603.46 g/mol |
| Exact Mass | 602.15 |
| IUPAC Name | (E)-N-[4-(3-chloro-4-fluoroanilino)-3-cyano-7-ethoxyquinolin-6-yl]-4-[[1-(2-fluoroethyl)triazol-4-yl]methylamino]but-2-enamide;hydrochloride |
| SMILES | CCOc1cc2ncc(C#N)c(Nc3ccc(F)c(Cl)c3)c2cc1NC(=O)/C=C/CNCc1cn(CCF)nn1.Cl |
| InChI | InChI=1S/C27H25ClF2N8O2.ClH/c1-2-40-25-12-23-20(27(17(13-31)14-33-23)34-18-5-6-22(30)21(28)10-18)11-24(25)35-26(39)4-3-8-32-15-19-16-38(9-7-29)37-36-19;/h3-6,10-12,14,16,32H,2,7-9,15H2,1H3,(H,33,34)(H,35,39);1H/b4-3+; |
| InChIKey | PSZJQBDEIQREEM-BJILWQEISA-N |
| XLogP | 5.31 |
| TPSA | 129.78 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 603.46 |
| LogP ≤ 5 | 5.31 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|