C23H22ClFN4O4S2 — CID 135236881
N-[4-(3-chloro-4-fluoroanilino)-3-cyano-7-ethoxyquinolin-6-yl]-2-(1,1-dihydroxydithiolan-3-yl)acetamide (PubChem CID 135236881) has the molecular formula C23H22ClFN4O4S2 and a molecular weight of 537.04 g/mol. Its IUPAC name is N-[4-(3-chloro-4-fluoroanilino)-3-cyano-7-ethoxyquinolin-6-yl]-2-(1,1-dihydroxydithiolan-3-yl)acetamide.
| Compound Name | N-[4-(3-chloro-4-fluoroanilino)-3-cyano-7-ethoxyquinolin-6-yl]-2-(1,1-dihydroxydithiolan-3-yl)acetamide |
|---|---|
| PubChem CID | 135236881 |
| Molecular Formula | C23H22ClFN4O4S2 |
| Molecular Weight | 537.04 g/mol |
| Exact Mass | 536.08 |
| IUPAC Name | N-[4-(3-chloro-4-fluoroanilino)-3-cyano-7-ethoxyquinolin-6-yl]-2-(1,1-dihydroxydithiolan-3-yl)acetamide |
| SMILES | CCOc1cc2ncc(C#N)c(Nc3ccc(F)c(Cl)c3)c2cc1NC(=O)CC1CCS(O)(O)S1 |
| InChI | InChI=1S/C23H22ClFN4O4S2/c1-2-33-21-10-19-16(9-20(21)29-22(30)8-15-5-6-35(31,32)34-15)23(13(11-26)12-27-19)28-14-3-4-18(25)17(24)7-14/h3-4,7,9-10,12,15,31-32H,2,5-6,8H2,1H3,(H,27,28)(H,29,30) |
| InChIKey | XRHGGMAZJBDVRL-UHFFFAOYSA-N |
| XLogP | 6.54 |
| TPSA | 127.50 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 537.04 |
| LogP ≤ 5 | 6.54 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'disulphide', 'substructure': 'N/A'} |
|---|