C22H24ClFN4O6S2 — CID 135236615
N-[4-(3-chloro-4-fluoroanilino)-7-(2,3-dihydroxypropoxy)quinazolin-6-yl]-2-(1,1-dihydroxydithiolan-3-yl)acetamide (PubChem CID 135236615) has the molecular formula C22H24ClFN4O6S2 and a molecular weight of 559.04 g/mol. Its IUPAC name is N-[4-(3-chloro-4-fluoroanilino)-7-(2,3-dihydroxypropoxy)quinazolin-6-yl]-2-(1,1-dihydroxydithiolan-3-yl)acetamide.
| Compound Name | N-[4-(3-chloro-4-fluoroanilino)-7-(2,3-dihydroxypropoxy)quinazolin-6-yl]-2-(1,1-dihydroxydithiolan-3-yl)acetamide |
|---|---|
| PubChem CID | 135236615 |
| Molecular Formula | C22H24ClFN4O6S2 |
| Molecular Weight | 559.04 g/mol |
| Exact Mass | 558.08 |
| IUPAC Name | N-[4-(3-chloro-4-fluoroanilino)-7-(2,3-dihydroxypropoxy)quinazolin-6-yl]-2-(1,1-dihydroxydithiolan-3-yl)acetamide |
| SMILES | O=C(CC1CCS(O)(O)S1)Nc1cc2c(Nc3ccc(F)c(Cl)c3)ncnc2cc1OCC(O)CO |
| InChI | InChI=1S/C22H24ClFN4O6S2/c23-16-5-12(1-2-17(16)24)27-22-15-7-19(28-21(31)6-14-3-4-36(32,33)35-14)20(34-10-13(30)9-29)8-18(15)25-11-26-22/h1-2,5,7-8,11,13-14,29-30,32-33H,3-4,6,9-10H2,(H,28,31)(H,25,26,27) |
| InChIKey | LIUYKCXOOXFXCC-UHFFFAOYSA-N |
| XLogP | 4.40 |
| TPSA | 157.06 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 559.04 |
| LogP ≤ 5 | 4.40 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'disulphide', 'substructure': 'N/A'} |
|---|