C20H19ClFN4O6P — CID 69436478
[2-[[4-(3-chloro-4-fluoroanilino)-7-(oxolan-3-yloxy)quinazolin-6-yl]amino]-2-oxoethyl]phosphonic acid (PubChem CID 69436478) has the molecular formula C20H19ClFN4O6P and a molecular weight of 496.82 g/mol. Its IUPAC name is [2-[[4-(3-chloro-4-fluoroanilino)-7-(oxolan-3-yloxy)quinazolin-6-yl]amino]-2-oxoethyl]phosphonic acid.
| Compound Name | [2-[[4-(3-chloro-4-fluoroanilino)-7-(oxolan-3-yloxy)quinazolin-6-yl]amino]-2-oxoethyl]phosphonic acid |
|---|---|
| PubChem CID | 69436478 |
| Molecular Formula | C20H19ClFN4O6P |
| Molecular Weight | 496.82 g/mol |
| Exact Mass | 496.07 |
| IUPAC Name | [2-[[4-(3-chloro-4-fluoroanilino)-7-(oxolan-3-yloxy)quinazolin-6-yl]amino]-2-oxoethyl]phosphonic acid |
| SMILES | O=C(CP(=O)(O)O)Nc1cc2c(Nc3ccc(F)c(Cl)c3)ncnc2cc1OC1CCOC1 |
| InChI | InChI=1S/C20H19ClFN4O6P/c21-14-5-11(1-2-15(14)22)25-20-13-6-17(26-19(27)9-33(28,29)30)18(7-16(13)23-10-24-20)32-12-3-4-31-8-12/h1-2,5-7,10,12H,3-4,8-9H2,(H,26,27)(H,23,24,25)(H2,28,29,30) |
| InChIKey | FTDXHHMNBJQGLR-UHFFFAOYSA-N |
| XLogP | 3.45 |
| TPSA | 142.90 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 496.82 |
| LogP ≤ 5 | 3.45 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|