C26H18ClF5N4O4S — CID 170670876
N-[4-(3-chloro-4-fluoroanilino)-7-[(3S)-oxolan-3-yl]oxyquinazolin-6-yl]-2,3,4,5-tetrafluoro-6-methylsulfinylbenzamide (PubChem CID 170670876) has the molecular formula C26H18ClF5N4O4S and a molecular weight of 612.96 g/mol. Its IUPAC name is N-[4-(3-chloro-4-fluoroanilino)-7-[(3S)-oxolan-3-yl]oxyquinazolin-6-yl]-2,3,4,5-tetrafluoro-6-methylsulfinylbenzamide.
| Compound Name | N-[4-(3-chloro-4-fluoroanilino)-7-[(3S)-oxolan-3-yl]oxyquinazolin-6-yl]-2,3,4,5-tetrafluoro-6-methylsulfinylbenzamide |
|---|---|
| PubChem CID | 170670876 |
| Molecular Formula | C26H18ClF5N4O4S |
| Molecular Weight | 612.96 g/mol |
| Exact Mass | 612.07 |
| IUPAC Name | N-[4-(3-chloro-4-fluoroanilino)-7-[(3S)-oxolan-3-yl]oxyquinazolin-6-yl]-2,3,4,5-tetrafluoro-6-methylsulfinylbenzamide |
| SMILES | CS(=O)c1c(F)c(F)c(F)c(F)c1C(=O)Nc1cc2c(Nc3ccc(F)c(Cl)c3)ncnc2cc1O[C@H]1CCOC1 |
| InChI | InChI=1S/C26H18ClF5N4O4S/c1-41(38)24-19(20(29)21(30)22(31)23(24)32)26(37)36-17-7-13-16(8-18(17)40-12-4-5-39-9-12)33-10-34-25(13)35-11-2-3-15(28)14(27)6-11/h2-3,6-8,10,12H,4-5,9H2,1H3,(H,36,37)(H,33,34,35)/t12-,41?/m0/s1 |
| InChIKey | GTMGIMVVOUQRRS-ZNYYAWNBSA-N |
| XLogP | 5.88 |
| TPSA | 102.44 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 612.96 |
| LogP ≤ 5 | 5.88 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|