C24H24ClFN4O6S2 — CID 135236877
N-[4-(3-chloro-4-fluoroanilino)-3-cyano-7-(2,3-dihydroxypropoxy)quinolin-6-yl]-2-(2,2-dihydroxydithiolan-3-yl)acetamide (PubChem CID 135236877) has the molecular formula C24H24ClFN4O6S2 and a molecular weight of 583.06 g/mol. Its IUPAC name is N-[4-(3-chloro-4-fluoroanilino)-3-cyano-7-(2,3-dihydroxypropoxy)quinolin-6-yl]-2-(2,2-dihydroxydithiolan-3-yl)acetamide.
| Compound Name | N-[4-(3-chloro-4-fluoroanilino)-3-cyano-7-(2,3-dihydroxypropoxy)quinolin-6-yl]-2-(2,2-dihydroxydithiolan-3-yl)acetamide |
|---|---|
| PubChem CID | 135236877 |
| Molecular Formula | C24H24ClFN4O6S2 |
| Molecular Weight | 583.06 g/mol |
| Exact Mass | 582.08 |
| IUPAC Name | N-[4-(3-chloro-4-fluoroanilino)-3-cyano-7-(2,3-dihydroxypropoxy)quinolin-6-yl]-2-(2,2-dihydroxydithiolan-3-yl)acetamide |
| SMILES | N#Cc1cnc2cc(OCC(O)CO)c(NC(=O)CC3CCSS3(O)O)cc2c1Nc1ccc(F)c(Cl)c1 |
| InChI | InChI=1S/C24H24ClFN4O6S2/c25-18-5-14(1-2-19(18)26)29-24-13(9-27)10-28-20-8-22(36-12-15(32)11-31)21(7-17(20)24)30-23(33)6-16-3-4-37-38(16,34)35/h1-2,5,7-8,10,15-16,31-32,34-35H,3-4,6,11-12H2,(H,28,29)(H,30,33) |
| InChIKey | OVDTXNJFWOARGI-UHFFFAOYSA-N |
| XLogP | 4.87 |
| TPSA | 167.96 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 583.06 |
| LogP ≤ 5 | 4.87 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'disulphide', 'substructure': 'N/A'} |
|---|