C30H31N5O7 — CID 175061785
(Z)-but-2-enedioic acid;N-[3-cyano-7-ethoxy-4-(3-ethynylanilino)quinolin-6-yl]-4-(dimethylamino)but-2-enamide;hydrate (PubChem CID 175061785) has the molecular formula C30H31N5O7 and a molecular weight of 573.61 g/mol. Its IUPAC name is (Z)-but-2-enedioic acid;N-[3-cyano-7-ethoxy-4-(3-ethynylanilino)quinolin-6-yl]-4-(dimethylamino)but-2-enamide;hydrate.
| Compound Name | (Z)-but-2-enedioic acid;N-[3-cyano-7-ethoxy-4-(3-ethynylanilino)quinolin-6-yl]-4-(dimethylamino)but-2-enamide;hydrate |
|---|---|
| PubChem CID | 175061785 |
| Molecular Formula | C30H31N5O7 |
| Molecular Weight | 573.61 g/mol |
| Exact Mass | 573.22 |
| IUPAC Name | (Z)-but-2-enedioic acid;N-[3-cyano-7-ethoxy-4-(3-ethynylanilino)quinolin-6-yl]-4-(dimethylamino)but-2-enamide;hydrate |
| SMILES | C#Cc1cccc(Nc2c(C#N)cnc3cc(OCC)c(NC(=O)C=CCN(C)C)cc23)c1.O.O=C(O)/C=C\C(=O)O |
| InChI | InChI=1S/C26H25N5O2.C4H4O4.H2O/c1-5-18-9-7-10-20(13-18)29-26-19(16-27)17-28-22-15-24(33-6-2)23(14-21(22)26)30-25(32)11-8-12-31(3)4;5-3(6)1-2-4(7)8;/h1,7-11,13-15,17H,6,12H2,2-4H3,(H,28,29)(H,30,32);1-2H,(H,5,6)(H,7,8);1H2/b;2-1-; |
| InChIKey | VDXAIRBYBDODDI-FJOGWHKWSA-N |
| XLogP | 3.17 |
| TPSA | 196.38 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 42 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 573.61 |
| LogP ≤ 5 | 3.17 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|