C26H28BrN5O3 — CID 11649536
(E)-N-[4-(3-bromoanilino)-3-cyano-7-ethoxyquinolin-6-yl]-4-[2-methoxyethyl(methyl)amino]but-2-enamide (PubChem CID 11649536) has the molecular formula C26H28BrN5O3 and a molecular weight of 538.45 g/mol. Its IUPAC name is (E)-N-[4-(3-bromoanilino)-3-cyano-7-ethoxyquinolin-6-yl]-4-[2-methoxyethyl(methyl)amino]but-2-enamide.
| Compound Name | (E)-N-[4-(3-bromoanilino)-3-cyano-7-ethoxyquinolin-6-yl]-4-[2-methoxyethyl(methyl)amino]but-2-enamide |
|---|---|
| PubChem CID | 11649536 |
| Molecular Formula | C26H28BrN5O3 |
| Molecular Weight | 538.45 g/mol |
| Exact Mass | 537.14 |
| IUPAC Name | (E)-N-[4-(3-bromoanilino)-3-cyano-7-ethoxyquinolin-6-yl]-4-[2-methoxyethyl(methyl)amino]but-2-enamide |
| SMILES | CCOc1cc2ncc(C#N)c(Nc3cccc(Br)c3)c2cc1NC(=O)/C=C/CN(C)CCOC |
| InChI | InChI=1S/C26H28BrN5O3/c1-4-35-24-15-22-21(14-23(24)31-25(33)9-6-10-32(2)11-12-34-3)26(18(16-28)17-29-22)30-20-8-5-7-19(27)13-20/h5-9,13-15,17H,4,10-12H2,1-3H3,(H,29,30)(H,31,33)/b9-6+ |
| InChIKey | KGQPKURDOPATNA-RMKNXTFCSA-N |
| XLogP | 5.08 |
| TPSA | 99.51 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 538.45 |
| LogP ≤ 5 | 5.08 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|