C25H25N7O3 — CID 56592135
N-[3-cyano-7-(oxolan-3-yloxy)-4-(pyrimidin-2-ylamino)quinolin-6-yl]-2-piperidin-4-ylideneacetamide (PubChem CID 56592135) has the molecular formula C25H25N7O3 and a molecular weight of 471.52 g/mol. Its IUPAC name is N-[3-cyano-7-(oxolan-3-yloxy)-4-(pyrimidin-2-ylamino)quinolin-6-yl]-2-piperidin-4-ylideneacetamide.
| Compound Name | N-[3-cyano-7-(oxolan-3-yloxy)-4-(pyrimidin-2-ylamino)quinolin-6-yl]-2-piperidin-4-ylideneacetamide |
|---|---|
| PubChem CID | 56592135 |
| Molecular Formula | C25H25N7O3 |
| Molecular Weight | 471.52 g/mol |
| Exact Mass | 471.20 |
| IUPAC Name | N-[3-cyano-7-(oxolan-3-yloxy)-4-(pyrimidin-2-ylamino)quinolin-6-yl]-2-piperidin-4-ylideneacetamide |
| SMILES | N#Cc1cnc2cc(OC3CCOC3)c(NC(=O)C=C3CCNCC3)cc2c1Nc1ncccn1 |
| InChI | InChI=1S/C25H25N7O3/c26-13-17-14-30-20-12-22(35-18-4-9-34-15-18)21(31-23(33)10-16-2-7-27-8-3-16)11-19(20)24(17)32-25-28-5-1-6-29-25/h1,5-6,10-12,14,18,27H,2-4,7-9,15H2,(H,31,33)(H,28,29,30,32) |
| InChIKey | BKDZPNLMBHPKCS-UHFFFAOYSA-N |
| XLogP | 3.06 |
| TPSA | 134.08 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 471.52 |
| LogP ≤ 5 | 3.06 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|