C30H31N5O5 — CID 123643501
4-[bis(2-hydroxyethyl)amino]-N-[3-cyano-4-(3-ethynylanilino)-7-[(3S)-oxolan-3-yl]oxyquinolin-6-yl]but-2-enamide (PubChem CID 123643501) has the molecular formula C30H31N5O5 and a molecular weight of 541.61 g/mol. Its IUPAC name is 4-[bis(2-hydroxyethyl)amino]-N-[3-cyano-4-(3-ethynylanilino)-7-[(3S)-oxolan-3-yl]oxyquinolin-6-yl]but-2-enamide.
| Compound Name | 4-[bis(2-hydroxyethyl)amino]-N-[3-cyano-4-(3-ethynylanilino)-7-[(3S)-oxolan-3-yl]oxyquinolin-6-yl]but-2-enamide |
|---|---|
| PubChem CID | 123643501 |
| Molecular Formula | C30H31N5O5 |
| Molecular Weight | 541.61 g/mol |
| Exact Mass | 541.23 |
| IUPAC Name | 4-[bis(2-hydroxyethyl)amino]-N-[3-cyano-4-(3-ethynylanilino)-7-[(3S)-oxolan-3-yl]oxyquinolin-6-yl]but-2-enamide |
| SMILES | C#Cc1cccc(Nc2c(C#N)cnc3cc(O[C@H]4CCOC4)c(NC(=O)C=CCN(CCO)CCO)cc23)c1 |
| InChI | InChI=1S/C30H31N5O5/c1-2-21-5-3-6-23(15-21)33-30-22(18-31)19-32-26-17-28(40-24-8-14-39-20-24)27(16-25(26)30)34-29(38)7-4-9-35(10-12-36)11-13-37/h1,3-7,15-17,19,24,36-37H,8-14,20H2,(H,32,33)(H,34,38)/t24-/m0/s1 |
| InChIKey | WKBOQACDCLUVRD-DEOSSOPVSA-N |
| XLogP | 2.78 |
| TPSA | 139.97 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 40 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 541.61 |
| LogP ≤ 5 | 2.78 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|