C29H22ClN5O4 — CID 89496358
4-[[1-[(3-chlorophenyl)methyl]indol-5-yl]amino]-6-nitro-7-(oxolan-3-yloxy)quinoline-3-carbonitrile (PubChem CID 89496358) has the molecular formula C29H22ClN5O4 and a molecular weight of 539.98 g/mol. Its IUPAC name is 4-[[1-[(3-chlorophenyl)methyl]indol-5-yl]amino]-6-nitro-7-(oxolan-3-yloxy)quinoline-3-carbonitrile.
| Compound Name | 4-[[1-[(3-chlorophenyl)methyl]indol-5-yl]amino]-6-nitro-7-(oxolan-3-yloxy)quinoline-3-carbonitrile |
|---|---|
| PubChem CID | 89496358 |
| Molecular Formula | C29H22ClN5O4 |
| Molecular Weight | 539.98 g/mol |
| Exact Mass | 539.14 |
| IUPAC Name | 4-[[1-[(3-chlorophenyl)methyl]indol-5-yl]amino]-6-nitro-7-(oxolan-3-yloxy)quinoline-3-carbonitrile |
| SMILES | N#Cc1cnc2cc(OC3CCOC3)c([N+](=O)[O-])cc2c1Nc1ccc2c(ccn2Cc2cccc(Cl)c2)c1 |
| InChI | InChI=1S/C29H22ClN5O4/c30-21-3-1-2-18(10-21)16-34-8-6-19-11-22(4-5-26(19)34)33-29-20(14-31)15-32-25-13-28(39-23-7-9-38-17-23)27(35(36)37)12-24(25)29/h1-6,8,10-13,15,23H,7,9,16-17H2,(H,32,33) |
| InChIKey | UJJZXESZPZJYJU-UHFFFAOYSA-N |
| XLogP | 6.58 |
| TPSA | 115.24 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 539.98 |
| LogP ≤ 5 | 6.58 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|