C32H33N5O — CID 123505937
6-amino-4-[(1-benzylindol-5-yl)amino]-7-heptan-3-yloxyquinoline-3-carbonitrile (PubChem CID 123505937) has the molecular formula C32H33N5O and a molecular weight of 503.65 g/mol. Its IUPAC name is 6-amino-4-[(1-benzylindol-5-yl)amino]-7-heptan-3-yloxyquinoline-3-carbonitrile.
| Compound Name | 6-amino-4-[(1-benzylindol-5-yl)amino]-7-heptan-3-yloxyquinoline-3-carbonitrile |
|---|---|
| PubChem CID | 123505937 |
| Molecular Formula | C32H33N5O |
| Molecular Weight | 503.65 g/mol |
| Exact Mass | 503.27 |
| IUPAC Name | 6-amino-4-[(1-benzylindol-5-yl)amino]-7-heptan-3-yloxyquinoline-3-carbonitrile |
| SMILES | CCCCC(CC)Oc1cc2ncc(C#N)c(Nc3ccc4c(ccn4Cc4ccccc4)c3)c2cc1N |
| InChI | InChI=1S/C32H33N5O/c1-3-5-11-26(4-2)38-31-18-29-27(17-28(31)34)32(24(19-33)20-35-29)36-25-12-13-30-23(16-25)14-15-37(30)21-22-9-7-6-8-10-22/h6-10,12-18,20,26H,3-5,11,21,34H2,1-2H3,(H,35,36) |
| InChIKey | NZGSGQVDYRKALU-UHFFFAOYSA-N |
| XLogP | 7.78 |
| TPSA | 88.89 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 503.65 |
| LogP ≤ 5 | 7.78 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|