C20H15ClN6OS — CID 10273818
6-amino-4-(3-chloro-4-imidazol-1-ylsulfanylanilino)-7-methoxyquinoline-3-carbonitrile (PubChem CID 10273818) has the molecular formula C20H15ClN6OS and a molecular weight of 422.90 g/mol. Its IUPAC name is 6-amino-4-(3-chloro-4-imidazol-1-ylsulfanylanilino)-7-methoxyquinoline-3-carbonitrile.
| Compound Name | 6-amino-4-(3-chloro-4-imidazol-1-ylsulfanylanilino)-7-methoxyquinoline-3-carbonitrile |
|---|---|
| PubChem CID | 10273818 |
| Molecular Formula | C20H15ClN6OS |
| Molecular Weight | 422.90 g/mol |
| Exact Mass | 422.07 |
| IUPAC Name | 6-amino-4-(3-chloro-4-imidazol-1-ylsulfanylanilino)-7-methoxyquinoline-3-carbonitrile |
| SMILES | COc1cc2ncc(C#N)c(Nc3ccc(Sn4ccnc4)c(Cl)c3)c2cc1N |
| InChI | InChI=1S/C20H15ClN6OS/c1-28-18-8-17-14(7-16(18)23)20(12(9-22)10-25-17)26-13-2-3-19(15(21)6-13)29-27-5-4-24-11-27/h2-8,10-11H,23H2,1H3,(H,25,26) |
| InChIKey | UCWIVUKGTCSEBQ-UHFFFAOYSA-N |
| XLogP | 4.85 |
| TPSA | 101.78 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 422.90 |
| LogP ≤ 5 | 4.85 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|