C28H26N6O — CID 177179071
6-amino-7-ethoxy-2-ethyl-4-[[1-(pyridin-3-ylmethyl)indol-5-yl]amino]quinoline-3-carbonitrile (PubChem CID 177179071) has the molecular formula C28H26N6O and a molecular weight of 462.56 g/mol. Its IUPAC name is 6-amino-7-ethoxy-2-ethyl-4-[[1-(pyridin-3-ylmethyl)indol-5-yl]amino]quinoline-3-carbonitrile.
| Compound Name | 6-amino-7-ethoxy-2-ethyl-4-[[1-(pyridin-3-ylmethyl)indol-5-yl]amino]quinoline-3-carbonitrile |
|---|---|
| PubChem CID | 177179071 |
| Molecular Formula | C28H26N6O |
| Molecular Weight | 462.56 g/mol |
| Exact Mass | 462.22 |
| IUPAC Name | 6-amino-7-ethoxy-2-ethyl-4-[[1-(pyridin-3-ylmethyl)indol-5-yl]amino]quinoline-3-carbonitrile |
| SMILES | CCOc1cc2nc(CC)c(C#N)c(Nc3ccc4c(ccn4Cc4cccnc4)c3)c2cc1N |
| InChI | InChI=1S/C28H26N6O/c1-3-24-22(15-29)28(21-13-23(30)27(35-4-2)14-25(21)33-24)32-20-7-8-26-19(12-20)9-11-34(26)17-18-6-5-10-31-16-18/h5-14,16H,3-4,17,30H2,1-2H3,(H,32,33) |
| InChIKey | CKNMIIWLFSKMAZ-UHFFFAOYSA-N |
| XLogP | 5.79 |
| TPSA | 101.78 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 462.56 |
| LogP ≤ 5 | 5.79 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|