C27H25N7O — CID 177179652
6-amino-7-ethoxy-2-ethyl-4-[[2-(pyridin-3-ylmethyl)indazol-5-yl]amino]quinoline-3-carbonitrile (PubChem CID 177179652) has the molecular formula C27H25N7O and a molecular weight of 463.55 g/mol. Its IUPAC name is 6-amino-7-ethoxy-2-ethyl-4-[[2-(pyridin-3-ylmethyl)indazol-5-yl]amino]quinoline-3-carbonitrile.
| Compound Name | 6-amino-7-ethoxy-2-ethyl-4-[[2-(pyridin-3-ylmethyl)indazol-5-yl]amino]quinoline-3-carbonitrile |
|---|---|
| PubChem CID | 177179652 |
| Molecular Formula | C27H25N7O |
| Molecular Weight | 463.55 g/mol |
| Exact Mass | 463.21 |
| IUPAC Name | 6-amino-7-ethoxy-2-ethyl-4-[[2-(pyridin-3-ylmethyl)indazol-5-yl]amino]quinoline-3-carbonitrile |
| SMILES | CCOc1cc2nc(CC)c(C#N)c(Nc3ccc4nn(Cc5cccnc5)cc4c3)c2cc1N |
| InChI | InChI=1S/C27H25N7O/c1-3-23-21(13-28)27(20-11-22(29)26(35-4-2)12-25(20)32-23)31-19-7-8-24-18(10-19)16-34(33-24)15-17-6-5-9-30-14-17/h5-12,14,16H,3-4,15,29H2,1-2H3,(H,31,32) |
| InChIKey | MOHRRSBGCKVIQD-UHFFFAOYSA-N |
| XLogP | 5.19 |
| TPSA | 114.67 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 463.55 |
| LogP ≤ 5 | 5.19 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|