C32H36ClN5O3 — CID 177179136
6-amino-4-[3-chloro-4-[[6-(oxan-4-yl)-3-pyridinyl]methoxy]anilino]-7-ethoxy-2-methylquinoline-3-carbonitrile;ethane (PubChem CID 177179136) has the molecular formula C32H36ClN5O3 and a molecular weight of 574.13 g/mol. Its IUPAC name is 6-amino-4-[3-chloro-4-[[6-(oxan-4-yl)-3-pyridinyl]methoxy]anilino]-7-ethoxy-2-methylquinoline-3-carbonitrile;ethane.
| Compound Name | 6-amino-4-[3-chloro-4-[[6-(oxan-4-yl)-3-pyridinyl]methoxy]anilino]-7-ethoxy-2-methylquinoline-3-carbonitrile;ethane |
|---|---|
| PubChem CID | 177179136 |
| Molecular Formula | C32H36ClN5O3 |
| Molecular Weight | 574.13 g/mol |
| Exact Mass | 573.25 |
| IUPAC Name | 6-amino-4-[3-chloro-4-[[6-(oxan-4-yl)-3-pyridinyl]methoxy]anilino]-7-ethoxy-2-methylquinoline-3-carbonitrile;ethane |
| SMILES | CC.CCOc1cc2nc(C)c(C#N)c(Nc3ccc(OCc4ccc(C5CCOCC5)nc4)c(Cl)c3)c2cc1N |
| InChI | InChI=1S/C30H30ClN5O3.C2H6/c1-3-38-29-14-27-22(13-25(29)33)30(23(15-32)18(2)35-27)36-21-5-7-28(24(31)12-21)39-17-19-4-6-26(34-16-19)20-8-10-37-11-9-20;1-2/h4-7,12-14,16,20H,3,8-11,17,33H2,1-2H3,(H,35,36);1-2H3 |
| InChIKey | QLELTACTYDQVMU-UHFFFAOYSA-N |
| XLogP | 7.69 |
| TPSA | 115.31 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 574.13 |
| LogP ≤ 5 | 7.69 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|