C21H19ClN4O3 — CID 177179628
N-[4-(3-chloro-4-methoxyanilino)-3-cyano-7-ethoxy-2-methylquinolin-6-yl]formamide (PubChem CID 177179628) has the molecular formula C21H19ClN4O3 and a molecular weight of 410.86 g/mol. Its IUPAC name is N-[4-(3-chloro-4-methoxyanilino)-3-cyano-7-ethoxy-2-methylquinolin-6-yl]formamide.
| Compound Name | N-[4-(3-chloro-4-methoxyanilino)-3-cyano-7-ethoxy-2-methylquinolin-6-yl]formamide |
|---|---|
| PubChem CID | 177179628 |
| Molecular Formula | C21H19ClN4O3 |
| Molecular Weight | 410.86 g/mol |
| Exact Mass | 410.11 |
| IUPAC Name | N-[4-(3-chloro-4-methoxyanilino)-3-cyano-7-ethoxy-2-methylquinolin-6-yl]formamide |
| SMILES | CCOc1cc2nc(C)c(C#N)c(Nc3ccc(OC)c(Cl)c3)c2cc1NC=O |
| InChI | InChI=1S/C21H19ClN4O3/c1-4-29-20-9-17-14(8-18(20)24-11-27)21(15(10-23)12(2)25-17)26-13-5-6-19(28-3)16(22)7-13/h5-9,11H,4H2,1-3H3,(H,24,27)(H,25,26) |
| InChIKey | CEUDYSZLSPNLHN-UHFFFAOYSA-N |
| XLogP | 4.79 |
| TPSA | 96.27 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 410.86 |
| LogP ≤ 5 | 4.79 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|