C31H36ClN7O3 — CID 177179443
(E)-N-[4-[4-[(E)-3-amino-2-(methyliminomethyl)prop-2-enoxy]-3-chloroanilino]-3-cyano-7-ethoxy-2-ethylquinolin-6-yl]-4-(dimethylamino)but-2-enamide (PubChem CID 177179443) has the molecular formula C31H36ClN7O3 and a molecular weight of 590.13 g/mol. Its IUPAC name is (E)-N-[4-[4-[(E)-3-amino-2-(methyliminomethyl)prop-2-enoxy]-3-chloroanilino]-3-cyano-7-ethoxy-2-ethylquinolin-6-yl]-4-(dimethylamino)but-2-enamide.
| Compound Name | (E)-N-[4-[4-[(E)-3-amino-2-(methyliminomethyl)prop-2-enoxy]-3-chloroanilino]-3-cyano-7-ethoxy-2-ethylquinolin-6-yl]-4-(dimethylamino)but-2-enamide |
|---|---|
| PubChem CID | 177179443 |
| Molecular Formula | C31H36ClN7O3 |
| Molecular Weight | 590.13 g/mol |
| Exact Mass | 589.26 |
| IUPAC Name | (E)-N-[4-[4-[(E)-3-amino-2-(methyliminomethyl)prop-2-enoxy]-3-chloroanilino]-3-cyano-7-ethoxy-2-ethylquinolin-6-yl]-4-(dimethylamino)but-2-enamide |
| SMILES | CCOc1cc2nc(CC)c(C#N)c(Nc3ccc(OCC(/C=N/C)=C/N)c(Cl)c3)c2cc1NC(=O)/C=C/CN(C)C |
| InChI | InChI=1S/C31H36ClN7O3/c1-6-25-23(17-34)31(36-21-10-11-28(24(32)13-21)42-19-20(16-33)18-35-3)22-14-27(29(41-7-2)15-26(22)37-25)38-30(40)9-8-12-39(4)5/h8-11,13-16,18H,6-7,12,19,33H2,1-5H3,(H,36,37)(H,38,40)/b9-8+,20-16+,35-18+ |
| InChIKey | PMQIWLDKMHWVND-LLJWYEMGSA-N |
| XLogP | 5.44 |
| TPSA | 137.89 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 590.13 |
| LogP ≤ 5 | 5.44 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|