C35H36ClN5O4 — CID 177179634
(E)-N-[4-[3-chloro-4-[[6-(oxan-4-yl)-3-pyridinyl]methoxy]anilino]-3-cyano-7-ethoxy-2-ethylquinolin-6-yl]but-2-enamide (PubChem CID 177179634) has the molecular formula C35H36ClN5O4 and a molecular weight of 626.16 g/mol. Its IUPAC name is (E)-N-[4-[3-chloro-4-[[6-(oxan-4-yl)-3-pyridinyl]methoxy]anilino]-3-cyano-7-ethoxy-2-ethylquinolin-6-yl]but-2-enamide.
| Compound Name | (E)-N-[4-[3-chloro-4-[[6-(oxan-4-yl)-3-pyridinyl]methoxy]anilino]-3-cyano-7-ethoxy-2-ethylquinolin-6-yl]but-2-enamide |
|---|---|
| PubChem CID | 177179634 |
| Molecular Formula | C35H36ClN5O4 |
| Molecular Weight | 626.16 g/mol |
| Exact Mass | 625.25 |
| IUPAC Name | (E)-N-[4-[3-chloro-4-[[6-(oxan-4-yl)-3-pyridinyl]methoxy]anilino]-3-cyano-7-ethoxy-2-ethylquinolin-6-yl]but-2-enamide |
| SMILES | C/C=C/C(=O)Nc1cc2c(Nc3ccc(OCc4ccc(C5CCOCC5)nc4)c(Cl)c3)c(C#N)c(CC)nc2cc1OCC |
| InChI | InChI=1S/C35H36ClN5O4/c1-4-7-34(42)41-31-17-25-30(18-33(31)44-6-3)40-28(5-2)26(19-37)35(25)39-24-9-11-32(27(36)16-24)45-21-22-8-10-29(38-20-22)23-12-14-43-15-13-23/h4,7-11,16-18,20,23H,5-6,12-15,21H2,1-3H3,(H,39,40)(H,41,42)/b7-4+ |
| InChIKey | SDJZCCMQMCJEFZ-QPJJXVBHSA-N |
| XLogP | 7.85 |
| TPSA | 118.39 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 626.16 |
| LogP ≤ 5 | 7.85 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|