C31H36N8O2 — CID 177179110
(E)-N-[3-cyano-7-ethoxy-2-ethyl-4-[(1-ethylindazol-5-yl)amino]quinolin-6-yl]-4-piperazin-1-ylbut-2-enamide (PubChem CID 177179110) has the molecular formula C31H36N8O2 and a molecular weight of 552.68 g/mol. Its IUPAC name is (E)-N-[3-cyano-7-ethoxy-2-ethyl-4-[(1-ethylindazol-5-yl)amino]quinolin-6-yl]-4-piperazin-1-ylbut-2-enamide.
| Compound Name | (E)-N-[3-cyano-7-ethoxy-2-ethyl-4-[(1-ethylindazol-5-yl)amino]quinolin-6-yl]-4-piperazin-1-ylbut-2-enamide |
|---|---|
| PubChem CID | 177179110 |
| Molecular Formula | C31H36N8O2 |
| Molecular Weight | 552.68 g/mol |
| Exact Mass | 552.30 |
| IUPAC Name | (E)-N-[3-cyano-7-ethoxy-2-ethyl-4-[(1-ethylindazol-5-yl)amino]quinolin-6-yl]-4-piperazin-1-ylbut-2-enamide |
| SMILES | CCOc1cc2nc(CC)c(C#N)c(Nc3ccc4c(cnn4CC)c3)c2cc1NC(=O)/C=C/CN1CCNCC1 |
| InChI | InChI=1S/C31H36N8O2/c1-4-25-24(19-32)31(35-22-9-10-28-21(16-22)20-34-39(28)5-2)23-17-27(29(41-6-3)18-26(23)36-25)37-30(40)8-7-13-38-14-11-33-12-15-38/h7-10,16-18,20,33H,4-6,11-15H2,1-3H3,(H,35,36)(H,37,40)/b8-7+ |
| InChIKey | FBNANAGFNPPWJO-BQYQJAHWSA-N |
| XLogP | 4.58 |
| TPSA | 120.13 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 41 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 552.68 |
| LogP ≤ 5 | 4.58 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|