C31H28ClN7O3 — CID 177179278
(E)-4-chloro-N-[3-cyano-7-ethoxy-2-ethyl-4-[3-methyl-4-([1,2,4]triazolo[1,5-a]pyridin-7-yloxy)anilino]quinolin-6-yl]but-2-enamide (PubChem CID 177179278) has the molecular formula C31H28ClN7O3 and a molecular weight of 582.06 g/mol. Its IUPAC name is (E)-4-chloro-N-[3-cyano-7-ethoxy-2-ethyl-4-[3-methyl-4-([1,2,4]triazolo[1,5-a]pyridin-7-yloxy)anilino]quinolin-6-yl]but-2-enamide.
| Compound Name | (E)-4-chloro-N-[3-cyano-7-ethoxy-2-ethyl-4-[3-methyl-4-([1,2,4]triazolo[1,5-a]pyridin-7-yloxy)anilino]quinolin-6-yl]but-2-enamide |
|---|---|
| PubChem CID | 177179278 |
| Molecular Formula | C31H28ClN7O3 |
| Molecular Weight | 582.06 g/mol |
| Exact Mass | 581.19 |
| IUPAC Name | (E)-4-chloro-N-[3-cyano-7-ethoxy-2-ethyl-4-[3-methyl-4-([1,2,4]triazolo[1,5-a]pyridin-7-yloxy)anilino]quinolin-6-yl]but-2-enamide |
| SMILES | CCOc1cc2nc(CC)c(C#N)c(Nc3ccc(Oc4ccn5ncnc5c4)c(C)c3)c2cc1NC(=O)/C=C/CCl |
| InChI | InChI=1S/C31H28ClN7O3/c1-4-24-23(17-33)31(22-15-26(38-30(40)7-6-11-32)28(41-5-2)16-25(22)37-24)36-20-8-9-27(19(3)13-20)42-21-10-12-39-29(14-21)34-18-35-39/h6-10,12-16,18H,4-5,11H2,1-3H3,(H,36,37)(H,38,40)/b7-6+ |
| InChIKey | TZUUUAISPBPKMZ-VOTSOKGWSA-N |
| XLogP | 6.69 |
| TPSA | 126.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 582.06 |
| LogP ≤ 5 | 6.69 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|