C31H32N8O3 — CID 162479812
(E)-N-[4-[4-[[2-(aminomethylideneamino)-4-pyridinyl]oxy]-3-methylanilino]-3-cyano-7-ethoxyquinolin-6-yl]-4-(dimethylamino)but-2-enamide (PubChem CID 162479812) has the molecular formula C31H32N8O3 and a molecular weight of 564.65 g/mol. Its IUPAC name is (E)-N-[4-[4-[[2-(aminomethylideneamino)-4-pyridinyl]oxy]-3-methylanilino]-3-cyano-7-ethoxyquinolin-6-yl]-4-(dimethylamino)but-2-enamide.
| Compound Name | (E)-N-[4-[4-[[2-(aminomethylideneamino)-4-pyridinyl]oxy]-3-methylanilino]-3-cyano-7-ethoxyquinolin-6-yl]-4-(dimethylamino)but-2-enamide |
|---|---|
| PubChem CID | 162479812 |
| Molecular Formula | C31H32N8O3 |
| Molecular Weight | 564.65 g/mol |
| Exact Mass | 564.26 |
| IUPAC Name | (E)-N-[4-[4-[[2-(aminomethylideneamino)-4-pyridinyl]oxy]-3-methylanilino]-3-cyano-7-ethoxyquinolin-6-yl]-4-(dimethylamino)but-2-enamide |
| SMILES | CCOc1cc2ncc(C#N)c(Nc3ccc(Oc4ccnc(/N=C/N)c4)c(C)c3)c2cc1NC(=O)/C=C/CN(C)C |
| InChI | InChI=1S/C31H32N8O3/c1-5-41-28-16-25-24(15-26(28)38-30(40)7-6-12-39(3)4)31(21(17-32)18-35-25)37-22-8-9-27(20(2)13-22)42-23-10-11-34-29(14-23)36-19-33/h6-11,13-16,18-19H,5,12H2,1-4H3,(H,35,37)(H,38,40)(H2,33,34,36)/b7-6+ |
| InChIKey | JWRDQTZRQROLSK-VOTSOKGWSA-N |
| XLogP | 5.42 |
| TPSA | 150.78 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 564.65 |
| LogP ≤ 5 | 5.42 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|