C29H26ClN5O3 — CID 177179623
N-[4-[3-chloro-4-(pyridin-2-ylmethoxy)anilino]-3-cyano-7-ethoxy-2-ethylquinolin-6-yl]prop-2-enamide (PubChem CID 177179623) has the molecular formula C29H26ClN5O3 and a molecular weight of 528.01 g/mol. Its IUPAC name is N-[4-[3-chloro-4-(pyridin-2-ylmethoxy)anilino]-3-cyano-7-ethoxy-2-ethylquinolin-6-yl]prop-2-enamide.
| Compound Name | N-[4-[3-chloro-4-(pyridin-2-ylmethoxy)anilino]-3-cyano-7-ethoxy-2-ethylquinolin-6-yl]prop-2-enamide |
|---|---|
| PubChem CID | 177179623 |
| Molecular Formula | C29H26ClN5O3 |
| Molecular Weight | 528.01 g/mol |
| Exact Mass | 527.17 |
| IUPAC Name | N-[4-[3-chloro-4-(pyridin-2-ylmethoxy)anilino]-3-cyano-7-ethoxy-2-ethylquinolin-6-yl]prop-2-enamide |
| SMILES | C=CC(=O)Nc1cc2c(Nc3ccc(OCc4ccccn4)c(Cl)c3)c(C#N)c(CC)nc2cc1OCC |
| InChI | InChI=1S/C29H26ClN5O3/c1-4-23-21(16-31)29(20-14-25(35-28(36)5-2)27(37-6-3)15-24(20)34-23)33-18-10-11-26(22(30)13-18)38-17-19-9-7-8-12-32-19/h5,7-15H,2,4,6,17H2,1,3H3,(H,33,34)(H,35,36) |
| InChIKey | ZITCQGBFKGJKJZ-UHFFFAOYSA-N |
| XLogP | 6.56 |
| TPSA | 109.16 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 528.01 |
| LogP ≤ 5 | 6.56 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|