C25H22ClN5O2 — CID 177179101
6-amino-4-[3-chloro-4-(pyridin-2-ylmethoxy)anilino]-7-ethoxy-2-methylquinoline-3-carbonitrile (PubChem CID 177179101) has the molecular formula C25H22ClN5O2 and a molecular weight of 459.94 g/mol. Its IUPAC name is 6-amino-4-[3-chloro-4-(pyridin-2-ylmethoxy)anilino]-7-ethoxy-2-methylquinoline-3-carbonitrile.
| Compound Name | 6-amino-4-[3-chloro-4-(pyridin-2-ylmethoxy)anilino]-7-ethoxy-2-methylquinoline-3-carbonitrile |
|---|---|
| PubChem CID | 177179101 |
| Molecular Formula | C25H22ClN5O2 |
| Molecular Weight | 459.94 g/mol |
| Exact Mass | 459.15 |
| IUPAC Name | 6-amino-4-[3-chloro-4-(pyridin-2-ylmethoxy)anilino]-7-ethoxy-2-methylquinoline-3-carbonitrile |
| SMILES | CCOc1cc2nc(C)c(C#N)c(Nc3ccc(OCc4ccccn4)c(Cl)c3)c2cc1N |
| InChI | InChI=1S/C25H22ClN5O2/c1-3-32-24-12-22-18(11-21(24)28)25(19(13-27)15(2)30-22)31-16-7-8-23(20(26)10-16)33-14-17-6-4-5-9-29-17/h4-12H,3,14,28H2,1-2H3,(H,30,31) |
| InChIKey | DIGHZBMHXKECFM-UHFFFAOYSA-N |
| XLogP | 5.77 |
| TPSA | 106.08 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 459.94 |
| LogP ≤ 5 | 5.77 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|