C30H34ClN5O4 — CID 177179327
(E)-N-[4-(3-chloro-4-methoxyphenoxy)-3-cyano-7-ethoxy-2-ethylquinolin-6-yl]-4-(4-methylpiperazin-1-yl)but-2-enamide (PubChem CID 177179327) has the molecular formula C30H34ClN5O4 and a molecular weight of 564.09 g/mol. Its IUPAC name is (E)-N-[4-(3-chloro-4-methoxyphenoxy)-3-cyano-7-ethoxy-2-ethylquinolin-6-yl]-4-(4-methylpiperazin-1-yl)but-2-enamide.
| Compound Name | (E)-N-[4-(3-chloro-4-methoxyphenoxy)-3-cyano-7-ethoxy-2-ethylquinolin-6-yl]-4-(4-methylpiperazin-1-yl)but-2-enamide |
|---|---|
| PubChem CID | 177179327 |
| Molecular Formula | C30H34ClN5O4 |
| Molecular Weight | 564.09 g/mol |
| Exact Mass | 563.23 |
| IUPAC Name | (E)-N-[4-(3-chloro-4-methoxyphenoxy)-3-cyano-7-ethoxy-2-ethylquinolin-6-yl]-4-(4-methylpiperazin-1-yl)but-2-enamide |
| SMILES | CCOc1cc2nc(CC)c(C#N)c(Oc3ccc(OC)c(Cl)c3)c2cc1NC(=O)/C=C/CN1CCN(C)CC1 |
| InChI | InChI=1S/C30H34ClN5O4/c1-5-24-22(19-32)30(40-20-9-10-27(38-4)23(31)16-20)21-17-26(28(39-6-2)18-25(21)33-24)34-29(37)8-7-11-36-14-12-35(3)13-15-36/h7-10,16-18H,5-6,11-15H2,1-4H3,(H,34,37)/b8-7+ |
| InChIKey | RGRTUOVSTQYEBO-BQYQJAHWSA-N |
| XLogP | 5.26 |
| TPSA | 99.95 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 564.09 |
| LogP ≤ 5 | 5.26 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|