C16H16ClN3O2 — CID 177179154
N-(4-chloro-3-cyano-7-ethoxy-2-ethylquinolin-6-yl)acetamide (PubChem CID 177179154) has the molecular formula C16H16ClN3O2 and a molecular weight of 317.78 g/mol. Its IUPAC name is N-(4-chloro-3-cyano-7-ethoxy-2-ethylquinolin-6-yl)acetamide.
| Compound Name | N-(4-chloro-3-cyano-7-ethoxy-2-ethylquinolin-6-yl)acetamide |
|---|---|
| PubChem CID | 177179154 |
| Molecular Formula | C16H16ClN3O2 |
| Molecular Weight | 317.78 g/mol |
| Exact Mass | 317.09 |
| IUPAC Name | N-(4-chloro-3-cyano-7-ethoxy-2-ethylquinolin-6-yl)acetamide |
| SMILES | CCOc1cc2nc(CC)c(C#N)c(Cl)c2cc1NC(C)=O |
| InChI | InChI=1S/C16H16ClN3O2/c1-4-12-11(8-18)16(17)10-6-14(19-9(3)21)15(22-5-2)7-13(10)20-12/h6-7H,4-5H2,1-3H3,(H,19,21) |
| InChIKey | INCVJDWGJNGIQO-UHFFFAOYSA-N |
| XLogP | 3.68 |
| TPSA | 75.01 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 317.78 |
| LogP ≤ 5 | 3.68 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |