C18H21N5O2 — CID 177179665
(E)-4-amino-N-(4-amino-3-cyano-7-ethoxy-2-ethylquinolin-6-yl)but-2-enamide (PubChem CID 177179665) has the molecular formula C18H21N5O2 and a molecular weight of 339.40 g/mol. Its IUPAC name is (E)-4-amino-N-(4-amino-3-cyano-7-ethoxy-2-ethylquinolin-6-yl)but-2-enamide.
| Compound Name | (E)-4-amino-N-(4-amino-3-cyano-7-ethoxy-2-ethylquinolin-6-yl)but-2-enamide |
|---|---|
| PubChem CID | 177179665 |
| Molecular Formula | C18H21N5O2 |
| Molecular Weight | 339.40 g/mol |
| Exact Mass | 339.17 |
| IUPAC Name | (E)-4-amino-N-(4-amino-3-cyano-7-ethoxy-2-ethylquinolin-6-yl)but-2-enamide |
| SMILES | CCOc1cc2nc(CC)c(C#N)c(N)c2cc1NC(=O)/C=C/CN |
| InChI | InChI=1S/C18H21N5O2/c1-3-13-12(10-20)18(21)11-8-15(23-17(24)6-5-7-19)16(25-4-2)9-14(11)22-13/h5-6,8-9H,3-4,7,19H2,1-2H3,(H2,21,22)(H,23,24)/b6-5+ |
| InChIKey | CERUWPGOXJAXQD-AATRIKPKSA-N |
| XLogP | 2.10 |
| TPSA | 127.05 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 339.40 |
| LogP ≤ 5 | 2.10 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|