C24H23ClFN5O2 — CID 68742221
N-[4-(3-chloro-4-fluoroanilino)-2-cyano-7-ethoxyquinolin-6-yl]-4-(dimethylamino)but-2-enamide (PubChem CID 68742221) has the molecular formula C24H23ClFN5O2 and a molecular weight of 467.93 g/mol. Its IUPAC name is N-[4-(3-chloro-4-fluoroanilino)-2-cyano-7-ethoxyquinolin-6-yl]-4-(dimethylamino)but-2-enamide.
| Compound Name | N-[4-(3-chloro-4-fluoroanilino)-2-cyano-7-ethoxyquinolin-6-yl]-4-(dimethylamino)but-2-enamide |
|---|---|
| PubChem CID | 68742221 |
| Molecular Formula | C24H23ClFN5O2 |
| Molecular Weight | 467.93 g/mol |
| Exact Mass | 467.15 |
| IUPAC Name | N-[4-(3-chloro-4-fluoroanilino)-2-cyano-7-ethoxyquinolin-6-yl]-4-(dimethylamino)but-2-enamide |
| SMILES | CCOc1cc2nc(C#N)cc(Nc3ccc(F)c(Cl)c3)c2cc1NC(=O)C=CCN(C)C |
| InChI | InChI=1S/C24H23ClFN5O2/c1-4-33-23-13-21-17(12-22(23)30-24(32)6-5-9-31(2)3)20(11-16(14-27)29-21)28-15-7-8-19(26)18(25)10-15/h5-8,10-13H,4,9H2,1-3H3,(H,28,29)(H,30,32) |
| InChIKey | PEOVUMDODYTJGR-UHFFFAOYSA-N |
| XLogP | 5.10 |
| TPSA | 90.28 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 467.93 |
| LogP ≤ 5 | 5.10 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|