C19H15Cl2FN4O — CID 54537238
2-amino-6-(2-chloroethyl)-4-(3-chloro-4-fluoroanilino)-7-methoxyquinoline-3-carbonitrile (PubChem CID 54537238) has the molecular formula C19H15Cl2FN4O and a molecular weight of 405.26 g/mol. Its IUPAC name is 2-amino-6-(2-chloroethyl)-4-(3-chloro-4-fluoroanilino)-7-methoxyquinoline-3-carbonitrile.
| Compound Name | 2-amino-6-(2-chloroethyl)-4-(3-chloro-4-fluoroanilino)-7-methoxyquinoline-3-carbonitrile |
|---|---|
| PubChem CID | 54537238 |
| Molecular Formula | C19H15Cl2FN4O |
| Molecular Weight | 405.26 g/mol |
| Exact Mass | 404.06 |
| IUPAC Name | 2-amino-6-(2-chloroethyl)-4-(3-chloro-4-fluoroanilino)-7-methoxyquinoline-3-carbonitrile |
| SMILES | COc1cc2nc(N)c(C#N)c(Nc3ccc(F)c(Cl)c3)c2cc1CCCl |
| InChI | InChI=1S/C19H15Cl2FN4O/c1-27-17-8-16-12(6-10(17)4-5-20)18(13(9-23)19(24)26-16)25-11-2-3-15(22)14(21)7-11/h2-3,6-8H,4-5H2,1H3,(H3,24,25,26) |
| InChIKey | ZAQKTCSPLMKYGO-UHFFFAOYSA-N |
| XLogP | 5.01 |
| TPSA | 83.96 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 405.26 |
| LogP ≤ 5 | 5.01 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|