C25H23ClFN5O3 — CID 173194542
4-(3-chloro-4-fluoroanilino)-3-cyano-6-[4-(dimethylamino)-1-oxobut-2-en-2-yl]-7-ethoxyquinoline-2-carboxamide (PubChem CID 173194542) has the molecular formula C25H23ClFN5O3 and a molecular weight of 495.94 g/mol. Its IUPAC name is 4-(3-chloro-4-fluoroanilino)-3-cyano-6-[4-(dimethylamino)-1-oxobut-2-en-2-yl]-7-ethoxyquinoline-2-carboxamide.
| Compound Name | 4-(3-chloro-4-fluoroanilino)-3-cyano-6-[4-(dimethylamino)-1-oxobut-2-en-2-yl]-7-ethoxyquinoline-2-carboxamide |
|---|---|
| PubChem CID | 173194542 |
| Molecular Formula | C25H23ClFN5O3 |
| Molecular Weight | 495.94 g/mol |
| Exact Mass | 495.15 |
| IUPAC Name | 4-(3-chloro-4-fluoroanilino)-3-cyano-6-[4-(dimethylamino)-1-oxobut-2-en-2-yl]-7-ethoxyquinoline-2-carboxamide |
| SMILES | CCOc1cc2nc(C(N)=O)c(C#N)c(Nc3ccc(F)c(Cl)c3)c2cc1C(C=O)=CCN(C)C |
| InChI | InChI=1S/C25H23ClFN5O3/c1-4-35-22-11-21-17(10-16(22)14(13-33)7-8-32(2)3)23(18(12-28)24(31-21)25(29)34)30-15-5-6-20(27)19(26)9-15/h5-7,9-11,13H,4,8H2,1-3H3,(H2,29,34)(H,30,31) |
| InChIKey | UGPQQLGOGOBBKZ-UHFFFAOYSA-N |
| XLogP | 4.28 |
| TPSA | 121.34 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 495.94 |
| LogP ≤ 5 | 4.28 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|