C21H19N5OS — CID 177179076
6-amino-4-(1,3-benzothiazol-5-ylamino)-7-ethoxy-2-ethylquinoline-3-carbonitrile (PubChem CID 177179076) has the molecular formula C21H19N5OS and a molecular weight of 389.48 g/mol. Its IUPAC name is 6-amino-4-(1,3-benzothiazol-5-ylamino)-7-ethoxy-2-ethylquinoline-3-carbonitrile.
| Compound Name | 6-amino-4-(1,3-benzothiazol-5-ylamino)-7-ethoxy-2-ethylquinoline-3-carbonitrile |
|---|---|
| PubChem CID | 177179076 |
| Molecular Formula | C21H19N5OS |
| Molecular Weight | 389.48 g/mol |
| Exact Mass | 389.13 |
| IUPAC Name | 6-amino-4-(1,3-benzothiazol-5-ylamino)-7-ethoxy-2-ethylquinoline-3-carbonitrile |
| SMILES | CCOc1cc2nc(CC)c(C#N)c(Nc3ccc4scnc4c3)c2cc1N |
| InChI | InChI=1S/C21H19N5OS/c1-3-16-14(10-22)21(25-12-5-6-20-18(7-12)24-11-28-20)13-8-15(23)19(27-4-2)9-17(13)26-16/h5-9,11H,3-4,23H2,1-2H3,(H,25,26) |
| InChIKey | RJIXUMGUKFVMOA-UHFFFAOYSA-N |
| XLogP | 5.00 |
| TPSA | 96.85 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 389.48 |
| LogP ≤ 5 | 5.00 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|