C12H7N5S — CID 100621011
5-(1,3-benzothiazol-5-ylamino)pyrazine-2-carbonitrile (PubChem CID 100621011) has the molecular formula C12H7N5S and a molecular weight of 253.29 g/mol. Its IUPAC name is 5-(1,3-benzothiazol-5-ylamino)pyrazine-2-carbonitrile.
| Compound Name | 5-(1,3-benzothiazol-5-ylamino)pyrazine-2-carbonitrile |
|---|---|
| PubChem CID | 100621011 |
| Molecular Formula | C12H7N5S |
| Molecular Weight | 253.29 g/mol |
| Exact Mass | 253.04 |
| IUPAC Name | 5-(1,3-benzothiazol-5-ylamino)pyrazine-2-carbonitrile |
| SMILES | N#Cc1cnc(Nc2ccc3scnc3c2)cn1 |
| InChI | InChI=1S/C12H7N5S/c13-4-9-5-15-12(6-14-9)17-8-1-2-11-10(3-8)16-7-18-11/h1-3,5-7H,(H,15,17) |
| InChIKey | LIGSMMAMLDYEQI-UHFFFAOYSA-N |
| XLogP | 2.70 |
| TPSA | 74.49 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 253.29 |
| LogP ≤ 5 | 2.70 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |