C11H10N4S — CID 123852220
N-(4,5-dihydropyrimidin-6-yl)-1,3-benzothiazol-5-amine (PubChem CID 123852220) has the molecular formula C11H10N4S and a molecular weight of 230.30 g/mol. Its IUPAC name is N-(4,5-dihydropyrimidin-6-yl)-1,3-benzothiazol-5-amine.
| Compound Name | N-(4,5-dihydropyrimidin-6-yl)-1,3-benzothiazol-5-amine |
|---|---|
| PubChem CID | 123852220 |
| Molecular Formula | C11H10N4S |
| Molecular Weight | 230.30 g/mol |
| Exact Mass | 230.06 |
| IUPAC Name | N-(4,5-dihydropyrimidin-6-yl)-1,3-benzothiazol-5-amine |
| SMILES | C1=NCCC(Nc2ccc3scnc3c2)=N1 |
| InChI | InChI=1S/C11H10N4S/c1-2-10-9(14-7-16-10)5-8(1)15-11-3-4-12-6-13-11/h1-2,5-7H,3-4H2,(H,12,13,15) |
| InChIKey | CMAVDRDSOYWVSU-UHFFFAOYSA-N |
| XLogP | 2.54 |
| TPSA | 49.64 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 230.30 |
| LogP ≤ 5 | 2.54 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |