C15H12N4O2S2 — CID 57300758
4-[1,3-benzothiazol-5-ylcarbamoyl(sulfanyl)amino]benzamide (PubChem CID 57300758) has the molecular formula C15H12N4O2S2 and a molecular weight of 344.42 g/mol. Its IUPAC name is 4-[1,3-benzothiazol-5-ylcarbamoyl(sulfanyl)amino]benzamide.
| Compound Name | 4-[1,3-benzothiazol-5-ylcarbamoyl(sulfanyl)amino]benzamide |
|---|---|
| PubChem CID | 57300758 |
| Molecular Formula | C15H12N4O2S2 |
| Molecular Weight | 344.42 g/mol |
| Exact Mass | 344.04 |
| IUPAC Name | 4-[1,3-benzothiazol-5-ylcarbamoyl(sulfanyl)amino]benzamide |
| SMILES | NC(=O)c1ccc(N(S)C(=O)Nc2ccc3scnc3c2)cc1 |
| InChI | InChI=1S/C15H12N4O2S2/c16-14(20)9-1-4-11(5-2-9)19(22)15(21)18-10-3-6-13-12(7-10)17-8-23-13/h1-8,22H,(H2,16,20)(H,18,21) |
| InChIKey | GACJRAXYPIQOSV-UHFFFAOYSA-N |
| XLogP | 3.28 |
| TPSA | 88.32 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 344.42 |
| LogP ≤ 5 | 3.28 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|