About 4-[1,3-benzothiazol-5-ylcarbamoyl(sulfanyl)amino]benzamide
4-[1,3-benzothiazol-5-ylcarbamoyl(sulfanyl)amino]benzamide (PubChem CID 57300758) has the molecular formula C15H12N4O2S2
and a molecular weight of 344.42 g/mol. Its IUPAC name is 4-[1,3-benzothiazol-5-ylcarbamoyl(sulfanyl)amino]benzamide.
Molecular Properties
| Compound Name | 4-[1,3-benzothiazol-5-ylcarbamoyl(sulfanyl)amino]benzamide |
| PubChem CID | 57300758 |
| Molecular Formula | C15H12N4O2S2 |
| Molecular Weight | 344.42 g/mol |
| Exact Mass | 344.04 |
| IUPAC Name | 4-[1,3-benzothiazol-5-ylcarbamoyl(sulfanyl)amino]benzamide |
| SMILES | NC(=O)c1ccc(N(S)C(=O)Nc2ccc3scnc3c2)cc1 |
| InChI | InChI=1S/C15H12N4O2S2/c16-14(20)9-1-4-11(5-2-9)19(22)15(21)18-10-3-6-13-12(7-10)17-8-23-13/h1-8,22H,(H2,16,20)(H,18,21) |
| InChIKey | GACJRAXYPIQOSV-UHFFFAOYSA-N |
| XLogP | 3.28 |
| TPSA | 88.32 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 344.42 |
| LogP ≤ 5 | 3.28 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|
Analyze 4-[1,3-benzothiazol-5-ylcarbamoyl(sulfanyl)amino]benzamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-[1,3-benzothiazol-5-ylcarbamoyl(sulfanyl)amino]benzamide?
The IUPAC name of 4-[1,3-benzothiazol-5-ylcarbamoyl(sulfanyl)amino]benzamide (CID 57300758) is 4-[1,3-benzothiazol-5-ylcarbamoyl(sulfanyl)amino]benzamide.
What is the SMILES notation for 4-[1,3-benzothiazol-5-ylcarbamoyl(sulfanyl)amino]benzamide?
The canonical SMILES for 4-[1,3-benzothiazol-5-ylcarbamoyl(sulfanyl)amino]benzamide is NC(=O)c1ccc(N(S)C(=O)Nc2ccc3scnc3c2)cc1.
What is the InChIKey of 4-[1,3-benzothiazol-5-ylcarbamoyl(sulfanyl)amino]benzamide?
The InChIKey is GACJRAXYPIQOSV-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H12N4O2S2/c16-14(20)9-1-4-11(5-2-9)19(22)15(21)18-10-3-6-13-12(7-10)17-8-23-13/h1-8,22H,(H2,16,20)(H,18,21).
What are the key properties of 4-[1,3-benzothiazol-5-ylcarbamoyl(sulfanyl)amino]benzamide?
4-[1,3-benzothiazol-5-ylcarbamoyl(sulfanyl)amino]benzamide has a molecular weight of 344.42 g/mol, XLogP of 3.28, 3 rotatable bonds, 3 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 4-[1,3-benzothiazol-5-ylcarbamoyl(sulfanyl)amino]benzamide is sourced from PubChem (CID 57300758), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).