C12H6Cl2N2OS2 — CID 16804006
N-(1,3-benzothiazol-5-yl)-2,5-dichlorothiophene-3-carboxamide (PubChem CID 16804006) has the molecular formula C12H6Cl2N2OS2 and a molecular weight of 329.23 g/mol. Its IUPAC name is N-(1,3-benzothiazol-5-yl)-2,5-dichlorothiophene-3-carboxamide.
| Compound Name | N-(1,3-benzothiazol-5-yl)-2,5-dichlorothiophene-3-carboxamide |
|---|---|
| PubChem CID | 16804006 |
| Molecular Formula | C12H6Cl2N2OS2 |
| Molecular Weight | 329.23 g/mol |
| Exact Mass | 327.93 |
| IUPAC Name | N-(1,3-benzothiazol-5-yl)-2,5-dichlorothiophene-3-carboxamide |
| SMILES | O=C(Nc1ccc2scnc2c1)c1cc(Cl)sc1Cl |
| InChI | InChI=1S/C12H6Cl2N2OS2/c13-10-4-7(11(14)19-10)12(17)16-6-1-2-9-8(3-6)15-5-18-9/h1-5H,(H,16,17) |
| InChIKey | XPOBYXCECWUMIW-UHFFFAOYSA-N |
| XLogP | 4.92 |
| TPSA | 41.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 329.23 |
| LogP ≤ 5 | 4.92 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |