C16H10BrN3S — CID 171618380
N-(6-bromoquinolin-4-yl)-1,3-benzothiazol-5-amine (PubChem CID 171618380) has the molecular formula C16H10BrN3S and a molecular weight of 356.25 g/mol. Its IUPAC name is N-(6-bromoquinolin-4-yl)-1,3-benzothiazol-5-amine.
| Compound Name | N-(6-bromoquinolin-4-yl)-1,3-benzothiazol-5-amine |
|---|---|
| PubChem CID | 171618380 |
| Molecular Formula | C16H10BrN3S |
| Molecular Weight | 356.25 g/mol |
| Exact Mass | 354.98 |
| IUPAC Name | N-(6-bromoquinolin-4-yl)-1,3-benzothiazol-5-amine |
| SMILES | Brc1ccc2nccc(Nc3ccc4scnc4c3)c2c1 |
| InChI | InChI=1S/C16H10BrN3S/c17-10-1-3-13-12(7-10)14(5-6-18-13)20-11-2-4-16-15(8-11)19-9-21-16/h1-9H,(H,18,20) |
| InChIKey | HKEOVRSOFLWJAF-UHFFFAOYSA-N |
| XLogP | 5.35 |
| TPSA | 37.81 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 356.25 |
| LogP ≤ 5 | 5.35 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |