C22H21N4O4S2+ — CID 118339845
(2R)-1-[4-(1,3-benzothiazol-5-ylamino)quinolin-6-yl]sulfonyl-2-methylpyrrolidin-1-ium-1-carboxylic acid (PubChem CID 118339845) has the molecular formula C22H21N4O4S2+ and a molecular weight of 469.57 g/mol. Its IUPAC name is (2R)-1-[4-(1,3-benzothiazol-5-ylamino)quinolin-6-yl]sulfonyl-2-methylpyrrolidin-1-ium-1-carboxylic acid.
| Compound Name | (2R)-1-[4-(1,3-benzothiazol-5-ylamino)quinolin-6-yl]sulfonyl-2-methylpyrrolidin-1-ium-1-carboxylic acid |
|---|---|
| PubChem CID | 118339845 |
| Molecular Formula | C22H21N4O4S2+ |
| Molecular Weight | 469.57 g/mol |
| Exact Mass | 469.10 |
| IUPAC Name | (2R)-1-[4-(1,3-benzothiazol-5-ylamino)quinolin-6-yl]sulfonyl-2-methylpyrrolidin-1-ium-1-carboxylic acid |
| SMILES | C[C@@H]1CCC[N+]1(C(=O)O)S(=O)(=O)c1ccc2nccc(Nc3ccc4scnc4c3)c2c1 |
| InChI | InChI=1S/C22H20N4O4S2/c1-14-3-2-10-26(14,22(27)28)32(29,30)16-5-6-18-17(12-16)19(8-9-23-18)25-15-4-7-21-20(11-15)24-13-31-21/h4-9,11-14H,2-3,10H2,1H3,(H-,23,25,27,28)/p+1/t14-,26?/m1/s1 |
| InChIKey | UXOBZBQLZJQOME-ZUXKRAEMSA-O |
| XLogP | 4.95 |
| TPSA | 109.25 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 469.57 |
| LogP ≤ 5 | 4.95 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|